Phenethyl trans-cinnamate manufacturers
|
| | Phenethyl trans-cinnamate Basic information |
| Product Name: | Phenethyl trans-cinnamate | | Synonyms: | (E)-3-Phenylpropenoic acid phenethyl ester;Cinnamic acid 2-phenylethyl ester;Phenethyl trans-cinnamate;trans-Phenethyl cinnaMate;2-Propenoic acid, 3-phenyl-, 2-phenylethyl ester, (2E)-;trans-Phenethyl cinnaMate;2-Phenylethyl (E)-Cinnamate;(E)-Cinnamic Acid 2-Phenylethyl Ester | | CAS: | 63238-64-2 | | MF: | C17H16O2 | | MW: | 252.31 | | EINECS: | | | Product Categories: | | | Mol File: | 63238-64-2.mol |  |
| | Phenethyl trans-cinnamate Chemical Properties |
| Melting point | 54-56 °C | | Boiling point | 405.9±24.0 °C(Predicted) | | density | 1.108±0.06 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C17H16O2/c18-17(12-11-15-7-3-1-4-8-15)19-14-13-16-9-5-2-6-10-16/h1-12H,13-14H2/b12-11+ | | InChIKey | MJQVZIANGRDJBT-VAWYXSNFSA-N | | SMILES | C(OCCC1=CC=CC=C1)(=O)/C=C/C1=CC=CC=C1 |
| | Phenethyl trans-cinnamate Usage And Synthesis |
| Definition | ChEBI: 2-Phenylethyl 3-phenyl-2-propenoate is a cinnamate ester. |
| | Phenethyl trans-cinnamate Preparation Products And Raw materials |
|