| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
2-Heptylquinoline-4(1H)-one manufacturers
- HHQ
-
- $39.00
-
2026-07-15
- CAS:40522-46-1
- Purity: 99.88%
- Supply Ability: 10g
|
| | 2-Heptylquinoline-4(1H)-one Basic information |
| Product Name: | 2-Heptylquinoline-4(1H)-one | | Synonyms: | 2-Heptyl-4(1H)-quinolinone;2-Heptylquinoline-4(1H)-one;Dihydroakutine;Pseudane VII;2-Heptyl-4-quinolone;2-Heptylquinolin-4(1H)-one;4(1H)-Quinolinone, 2-heptyl-;2-heptyl-1H-quinolin-4-one | | CAS: | 40522-46-1 | | MF: | C16H21NO | | MW: | 243.34 | | EINECS: | | | Product Categories: | | | Mol File: | 40522-46-1.mol |  |
| | 2-Heptylquinoline-4(1H)-one Chemical Properties |
| Melting point | 122-126 °C | | Boiling point | 361.5±42.0 °C(Predicted) | | density | 1.013 | | storage temp. | 2-8°C | | solubility | DMSO: soluble5mg/mL, clear | | pka | 2.34±0.70(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C16H21NO/c1-2-3-4-5-6-9-13-12-16(18)14-10-7-8-11-15(14)17-13/h7-8,10-12H,2-6,9H2,1H3,(H,17,18) | | InChIKey | UYRHHBXYXSYGHA-UHFFFAOYSA-N | | SMILES | [nH]1c2c([c](cc1CCCCCCC)=O)cccc2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Heptylquinoline-4(1H)-one Usage And Synthesis |
| Uses | 2-Heptyl-4-quinolone is an intermediate in the synthesis of the Pseudomonas quinolone signal (PQS) that controls swarming by positively regulating phenazine production. 2-Heptyl-4-quinolone induces the production of the phenazine-1-carboxylic acid (PCA)[1]. | | Definition | ChEBI: A quinolone consisting of quinolin-4(1H)-one carrying a heptyl substituent at position 2. | | General Description | HHQ belongs to 2-alkyl-4-quinolone compounds, which are lipophilic and are slightly soluble in water. | | Biochem/physiol Actions | HHQ stimulates vesicle formation but not as much as PQS. | | References | [1] Ha DG, et al. 2-Heptyl-4-quinolone, a precursor of the Pseudomonas quinolone signal molecule, modulates swarming motility in Pseudomonas aeruginosa. J Bacteriol. 2011 Dec;193(23):6770-80. DOI:10.1128/JB.05929-11 |
| | 2-Heptylquinoline-4(1H)-one Preparation Products And Raw materials |
|