| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 13,6-(Epithioimino)pentacene-16-carboxylic acid, 6,13-dihydro-, tert butyl ester, 15-oxide Basic information |
| Product Name: | 13,6-(Epithioimino)pentacene-16-carboxylic acid, 6,13-dihydro-, tert butyl ester, 15-oxide | | Synonyms: | Pentacene-N-sulfinyl-tert-butylcarbaMate;SureCN11991189;13,6-(Epithioimino)pentacene-16-carboxylic acid, 6,13-dihydro-, 1,1-dimethylethyl ester, 15-oxide (9CI);Pentacene-N-sulfinyl-tert-butylcarbamate;13,6-(Epithioimino)pentacene-16-carboxylic acid, 6,13-dihydro-, tert butyl ester, 15-oxide | | CAS: | 794586-44-0 | | MF: | C27H23NO3S | | MW: | 441.54 | | EINECS: | | | Product Categories: | | | Mol File: | 794586-44-0.mol |  |
| | 13,6-(Epithioimino)pentacene-16-carboxylic acid, 6,13-dihydro-, tert butyl ester, 15-oxide Chemical Properties |
| Melting point | >300°C | | Boiling point | 644.7±65.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | solubility | THF: soluble1mg/mL | | pka | -3.13±0.20(Predicted) | | form | solid | | InChI | 1S/C27H23NO3S/c1-27(2,3)31-26(29)28-24-20-12-16-8-4-6-10-18(16)14-22(20)25(32(28)30)23-15-19-11-7-5-9-17(19)13-21(23)24/h4-15,24-25H,1-3H3 | | InChIKey | VQUHUWBRYQBGLV-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1C2c3cc4ccccc4cc3C(c5cc6ccccc6cc25)S1=O |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | 13,6-(Epithioimino)pentacene-16-carboxylic acid, 6,13-dihydro-, tert butyl ester, 15-oxide Usage And Synthesis |
| Uses | Photopatternable pentacene precursor highly solube in apolar organic solvents (halogenated solvents, THF). Converted to pentacene in thin (e.g. spin-cast) films by heating under N2 atmosphere for one hour at 150 °C. Spin-coated thin films of the pentacene precursor can be patterned by exposure to UV light in the presence of a photoacid generator (e.g. 531014), followed by a brief heating (5 min. at 130 °C and washing away of an un-converted precursor. Organic thin film transistors fabricated by solution processing of this precursor showed mobilities of 0.13 cm2V-1s-1 and on/off ratio 2 x 105. |
| | 13,6-(Epithioimino)pentacene-16-carboxylic acid, 6,13-dihydro-, tert butyl ester, 15-oxide Preparation Products And Raw materials |
|