|
|
| | FMOC-3,4-DEHYDRO-PRO-OH Basic information |
| | FMOC-3,4-DEHYDRO-PRO-OH Chemical Properties |
| Boiling point | 549.6±50.0 °C(Predicted) | | density | 1.356±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | form | Solid | | pka | 3+-.0.20(Predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C20H17NO4/c22-19(23)18-10-5-11-21(18)20(24)25-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-10,17-18H,11-12H2,(H,22,23)/t18-/m0/s1 | | InChIKey | OALUMAMYGOBVTF-SFHVURJKSA-N | | SMILES | N4([C@@H](C=CC4)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | WGK 2 water endangering | | HS Code | 2933 99 80 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | FMOC-3,4-DEHYDRO-PRO-OH Usage And Synthesis |
| Chemical Properties | White or off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-3,4-DEHYDRO-PRO-OH Preparation Products And Raw materials |
|