2,6-DIISOPROPYL-N,N-DIMETHYLANILINE manufacturers
|
| | 2,6-DIISOPROPYL-N,N-DIMETHYLANILINE Basic information |
| Product Name: | 2,6-DIISOPROPYL-N,N-DIMETHYLANILINE | | Synonyms: | n,n-dimethyl-2,6-bis(1-methylethyl)-benzenamin;2,6-DIISOPROPYL-N,N-DIMETHYLANILINE;N,N-Dimethyl-2,6-diisopropylaniline.;2 6-DIISOPROPYL-N N-DIMETHYLANILINE 96%;2,6-Diisopropyl-N,N-dimethylaniline,97%;N,N-dimethyl-2,6-di(propan-2-yl)aniline;Benzenamine, N,N-dimethyl-2,6-bis(1-methylethyl)-;2,6-Diisopropyl-N,N-dimethylaniline | | CAS: | 2909-77-5 | | MF: | C14H23N | | MW: | 205.34 | | EINECS: | | | Product Categories: | Building Blocks;C14 to C16;Chemical Synthesis;Nitrogen Compounds;Organic Building Blocks;Amines;C11 to C38;Nitrogen Compounds | | Mol File: | 2909-77-5.mol |  |
| | 2,6-DIISOPROPYL-N,N-DIMETHYLANILINE Chemical Properties |
| Boiling point | 86 °C2.5 mm Hg(lit.) | | density | 0.873 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C, protect from light | | pka | 6.06±0.36(Predicted) | | Specific Gravity | 0.873 | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C14H23N/c1-10(2)12-8-7-9-13(11(3)4)14(12)15(5)6/h7-11H,1-6H3 | | InChIKey | ALXIOUGHHXXLKX-UHFFFAOYSA-N | | SMILES | CC(C)c1cccc(C(C)C)c1N(C)C | | EPA Substance Registry System | N,N-Dimethyl-2,6-diisopropylaniline (2909-77-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN2810 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-DIISOPROPYL-N,N-DIMETHYLANILINE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 2,6-Diisopropyl-N,N-dimethylaniline may be used as a co-initiator in two-photon polymerization. | | General Description | 2,6-Diisopropyl-N,N-dimethylaniline (DIDMA) is a tertiary amine. It can undergo iron-catalyzed oxidative amidation with propionaldehyde (PrCHO) to form the corresponding hindered amide. |
| | 2,6-DIISOPROPYL-N,N-DIMETHYLANILINE Preparation Products And Raw materials |
|