| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
- AMBRISENTAN
-
- $1.00
-
2020-02-17
- CAS:713516-99-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | AMBRISENTAN Basic information |
| Product Name: | AMBRISENTAN | | Synonyms: | alpha-[(4,6-Dimethyl-2-pyrimidinyl)oxy]-beta-methoxy-beta-phenylbenzenepropanoic acid;rac Ambrisentan;2-(4,6-Dimethyl-pyrimidin-2-yloxy)-3-methoxy-3,3-diphenyl-propionic acid;Ambrisentan Racemate;Ambrisentan Impurity 1（Ambrisentan Racemate）;Benzenepropanoic acid, α-[(4,6-dimethyl-2-pyrimidinyl)oxy]-β-methoxy-β-phenyl- | | CAS: | 713516-99-5 | | MF: | C22H22N2O4 | | MW: | 378.43 | | EINECS: | | | Product Categories: | | | Mol File: | 713516-99-5.mol |  |
| | AMBRISENTAN Chemical Properties |
| Melting point | 177-179℃ (DEC.) | | Boiling point | 551.1±60.0 °C(Predicted) | | density | 1.228 | | pka | 0.97±0.10(Predicted) | | InChI | InChI=1S/C22H22N2O4/c1-15-14-16(2)24-21(23-15)28-19(20(25)26)22(27-3,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-14,19H,1-3H3,(H,25,26) | | InChIKey | OUJTZYPIHDYQMC-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)(C1C=CC=CC=1)(OC)C(C(=O)O)OC1=NC(C)=CC(C)=N1 |
| | AMBRISENTAN Usage And Synthesis |
| Uses | Nonpeptide endothelin ETA receptor antagonist. Antihypertensive. | | Definition | ChEBI: 2-[(4,6-dimethyl-2-pyrimidinyl)oxy]-3-methoxy-3,3-diphenylpropanoic acid is a diarylmethane. |
| | AMBRISENTAN Preparation Products And Raw materials |
|