|
|
| | 3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfonamide Basic information | | Application |
| Product Name: | 3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfonamide | | Synonyms: | 3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfonamide;3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide;3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfomide;2-ThiophenesulfonaMide,3-(2-broMoacetyl)-5-chloro-;3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfonamide(For export only);3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfonamide ISO 9001:2015 REACH;3-(2-BromoacetyI)- 5-chlorothiophene-2-sulfonamide;3-(Bromoacetyl)-5-chloro-2-thiophenesulphonamide | | CAS: | 160982-11-6 | | MF: | C6H5BrClNO3S2 | | MW: | 318.6 | | EINECS: | 605-241-0 | | Product Categories: | | | Mol File: | 160982-11-6.mol |  |
| | 3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfonamide Chemical Properties |
| Boiling point | 492.2±55.0 °C(Predicted) | | density | 1.936 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.21±0.60(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H5BrClNO3S2/c7-2-4(10)3-1-5(8)13-6(3)14(9,11)12/h1H,2H2,(H2,9,11,12) | | InChIKey | OZESFFKYLOCAOV-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)SC(Cl)=CC=1C(CBr)=O |
| | 3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfonamide Usage And Synthesis |
| Application | 3-(bromoacetyl)-5-chloro-2-thiophene sulfonamide is a heterocyclic organic compound that can be used as a pharmaceutical intermediate. |
| | 3-(2-Bromoacetyl)-5-chloro-2-thiophenesulfonamide Preparation Products And Raw materials |
|