- Lenacil
-
- $30.00 / 10mg
-
2026-04-20
- CAS:2164-08-1
- Min. Order:
- Purity: 99.71%
- Supply Ability: 10g
- Lenacil
-
- $0.00 / 1Kg
-
2020-02-26
- CAS: 2164-08-1
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 1000 tons
|
| | Lenacil Basic information |
| Product Name: | Lenacil | | Synonyms: | 1H-Cyclopentapyrimidine-2,4(3H,5H)-dione, 3-cyclohexyl-6,7-dihydro-;1H-Cyclopentapyrimidine-2,4(3H,5H)-dione, 6,7-dihydro-3-cyclohexyl-;3-Cyclohexyl-1,5,6,7-tetrahydo-2H-cyclopentapyrimidine-2,4(3H)-dione;3-Cyclohexyl-1,5,6,7-tetrahydrocyclopentapyrimidine-2,4(3H)-dione;3-Cyclohexyl-2-hydroxy-3,5,6,7-tetrahydro-4H-cyclopenta[d]pyrimidin-4-one;3-Cyclohexyl-5,6-trimethylenuracil;5h)-dione,6,7-dihydro-3-cyclohexyl-1h-cyclopentapyrimidine-4(3h;experimentalherbicide634 | | CAS: | 2164-08-1 | | MF: | C13H18N2O2 | | MW: | 234.29 | | EINECS: | 218-499-0 | | Product Categories: | | | Mol File: | 2164-08-1.mol |  |
| | Lenacil Chemical Properties |
| Melting point | 316-326°C | | Boiling point | 376.62°C (rough estimate) | | density | d20 1.32 kg/l | | refractive index | 1.6450 (estimate) | | storage temp. | 0-6°C | | form | Solid | | pka | 10.66±0.20(Predicted) | | color | White to off-white | | Water Solubility | 6mg/L(25 ºC) | | Merck | 13,5455 | | Henry's Law Constant | 1.3×105 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | Major Application | agriculture environmental | | InChI | 1S/C13H18N2O2/c16-12-10-7-4-8-11(10)14-13(17)15(12)9-5-2-1-3-6-9/h9H,1-8H2,(H,14,17) | | InChIKey | ZTMKADLOSYKWCA-UHFFFAOYSA-N | | SMILES | O=C1NC2=C(CCC2)C(=O)N1C3CCCCC3 | | LogP | 2.860 (est) | | CAS DataBase Reference | 2164-08-1(CAS DataBase Reference) | | NIST Chemistry Reference | Lenacil(2164-08-1) | | EPA Substance Registry System | Lenacil (2164-08-1) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 | | WGK Germany | WGK 2 | | RTECS | GY5875000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 | | Toxicity | LD50 (80% wettable powder) orally in rats: >11,000 mg/kg; LC50 96 hr in bluegill sunfish; rainbow trout: 100-1000; 135 mg/l; LC50 8 day in bobwhite quail, Peking duck (mg/kg): 2300, >5620. (DuPont technical data sheet) |
| | Lenacil Usage And Synthesis |
| Uses | Herbicide. | | Uses | Lenacil acts similarly in weed control. It is used preplanting
by soil incorporation or as a preemergence treatment of
fodder, red beets, and sugar beets. The chemical is also used
on spinach, strawberries, and various ornamentals. Usage
rates range from 0.4 to 1.2 kg/ha depending on the crop and
soil type. | | Uses | Lenacil is an herbicide used in the protection of crops. Non-cytotoxic agent. | | Definition | ChEBI: A cyclopentapyrimidine that is 6,7-dihydro-1H-cyclopenta[d]pyrimidine-2,4(3H,5H)-dione substituted by a cyclohexyl group at position 3. | | Agricultural Uses | Herbicide: Systemic herbicide that attacks roots. | | Trade name | LENAZAR FLO®; SAFARI LITE®;
VENZAR Flowable® |
| | Lenacil Preparation Products And Raw materials |
|