| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-pyridinecarboxylic acid, 5-chloro-6-(3-cyanophenoxy)- Basic information |
| | 3-pyridinecarboxylic acid, 5-chloro-6-(3-cyanophenoxy)- Chemical Properties |
| Boiling point | 436.2±45.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | pka | 3.13±0.10(Predicted) | | form | solid | | InChI | 1S/C13H7ClN2O3/c14-11-5-9(13(17)18)7-16-12(11)19-10-3-1-2-8(4-10)6-15/h1-5,7H,(H,17,18) | | InChIKey | YMWNZTGWQLPKKU-UHFFFAOYSA-N | | SMILES | ClC1=CC(C(O)=O)=CN=C1OC2=CC=CC(C#N)=C2 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 |
| | 3-pyridinecarboxylic acid, 5-chloro-6-(3-cyanophenoxy)- Usage And Synthesis |
| | 3-pyridinecarboxylic acid, 5-chloro-6-(3-cyanophenoxy)- Preparation Products And Raw materials |
|