| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3'-Bromobiphenyl-3-carboxylic acid, 95% Basic information |
| Product Name: | 3'-Bromobiphenyl-3-carboxylic acid, 95% | | Synonyms: | 3'-Bromobiphenyl-3-carboxylic acid, 95%;3'-Bromo-[1,1'-biphenyl]-3-carboxylic acid;3'-Bromo-3-carboxybiphenyl, 3-(3-Bromophenyl)benzoic acid;3'-Bromo-3-biphenylcarboxylic Acid;[1,1'-Biphenyl]-3-carboxylic acid, 3'-bromo-;3-(3-bromophenyl)benzoic acid;3'-Bromo[1,1'-biphenyl]-3-carboxylic acid;3′-Bromobiphenyl-3-carboxylic acid, CAS 854237-06-2 | | CAS: | 854237-06-2 | | MF: | C13H9BrO2 | | MW: | 277.11 | | EINECS: | | | Product Categories: | | | Mol File: | 854237-06-2.mol |  |
| | 3'-Bromobiphenyl-3-carboxylic acid, 95% Chemical Properties |
| Melting point | 192-196°C | | Boiling point | 426.2±28.0 °C(Predicted) | | density | 1.510±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.11±0.10(Predicted) | | form | solid | | Appearance | Off-white to gray Solid | | InChI | 1S/C13H9BrO2/c14-12-6-2-4-10(8-12)9-3-1-5-11(7-9)13(15)16/h1-8H,(H,15,16) | | InChIKey | MHIAOGTWZISBLM-UHFFFAOYSA-N | | SMILES | OC(=O)c1cccc(c1)-c2cccc(Br)c2 |
| Hazard Codes | Xn,N | | Risk Statements | 22-36-51 | | Safety Statements | 53-26-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 2 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Irrit. 2 |
| | 3'-Bromobiphenyl-3-carboxylic acid, 95% Usage And Synthesis |
| | 3'-Bromobiphenyl-3-carboxylic acid, 95% Preparation Products And Raw materials |
|