|
|
| | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole Basic information |
| Product Name: | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole | | Synonyms: | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole;2-Methylbenzooxazole-5-boronic acid, pinacol ester;2-Methyl-1,3-benzoxazole-5-boronic acid, pinacol ester;2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole;2-Methylbenzo[d]oxazol-5-ylboronic acid pinacol ester;2-Methylbenzoxazole-5-boronic acid, pinacol ester;Benzoxazole, 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | | CAS: | 845872-30-2 | | MF: | C14H18BNO3 | | MW: | 259.11 | | EINECS: | | | Product Categories: | | | Mol File: | 845872-30-2.mol | ![2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole Structure](CAS2/GIF/845872-30-2.gif) |
| | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole Chemical Properties |
| Boiling point | 364.0±15.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 0.58±0.10(Predicted) | | form | solid | | Appearance | White to yellow Solid | | InChI | 1S/C14H18BNO3/c1-9-16-11-8-10(6-7-12(11)17-9)15-18-13(2,3)14(4,5)19-15/h6-8H,1-5H3 | | InChIKey | BPSCJKYJEQQDQN-UHFFFAOYSA-N | | SMILES | B3(OC(C(O3)(C)C)(C)C)c1cc2nc([o]c2cc1)C |
| Risk Statements | 36 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole Usage And Synthesis |
| | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole Preparation Products And Raw materials |
|