|
|
| | 3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]- Basic information |
| Product Name: | 3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]- | | Synonyms: | 3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]-;1-[(4-Methylphenyl)sulfonyl]-3-azetidinone;1-(4-methylbenzenesulfonyl)azetidin-3-one;1-[(4-Methylphenyl)sulfonyl]-3-azetidinone 95%;3-aza-cyclobutanone, 1-[(4-methylphenyl) sulfonyl];N-Tosyl-3-azetidinone;N-(4-Tolylsulfonyl)azetidin-3-one;1-Tosylazetidin-3-one - [T6664] | | CAS: | 76543-27-6 | | MF: | C10H11NO3S | | MW: | 225.27 | | EINECS: | | | Product Categories: | | | Mol File: | 76543-27-6.mol | ![3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]- Structure](CAS2/GIF/76543-27-6.gif) |
| | 3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]- Chemical Properties |
| Melting point | 147-152°C | | Boiling point | 395.4±52.0 °C(Predicted) | | density | 1.389±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | -9.97±0.20(Predicted) | | Appearance | White to light yellow Solid | | InChI | 1S/C10H11NO3S/c1-8-2-4-10(5-3-8)15(13,14)11-6-9(12)7-11/h2-5H,6-7H2,1H3 | | InChIKey | YRVBXEVVGIQJOZ-UHFFFAOYSA-N | | SMILES | O=C1CN(S(C2=CC=C(C)C=C2)(=O)=O)C1 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]- Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 1-Tosylazetidin-3-one is a useful synthetic intermediate. It is used to synthesize Azaspiro[3.3]heptanes as building blocks for medicinal chemistry. |
| | 3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]- Preparation Products And Raw materials |
|