|
|
| | Diphosphoric acid compd. with-piperazine (1:1) Basic information | | Application |
| Product Name: | Diphosphoric acid compd. with-piperazine (1:1) | | Synonyms: | DIPHOSPHORIC ACID COMPD. WITH-PIPERAZINE;pyrophosphate piperazine;phosphono dihydrogen phosphate,piperazine;Piperazine diphosphate (PAPP);Diphosphoric Acid Piperazine;Pyrophosphoricacidpiperazinesalt;Piperazine Pyrophosphate;Diphosphoric acid compd. with-piperazine (1:1) | | CAS: | 66034-17-1 | | MF: | C4H14N2O7P2 | | MW: | 264.11 | | EINECS: | 457-330-7 | | Product Categories: | | | Mol File: | 66034-17-1.mol |  |
| | Diphosphoric acid compd. with-piperazine (1:1) Chemical Properties |
| density | 1.71 g/cm3 | | vapor pressure | 0Pa at 49℃ | | Water Solubility | 12.24g/L at 20℃ | | InChI | InChI=1S/C4H10N2.H4O7P2/c1-2-6-4-3-5-1;1-8(2,3)7-9(4,5)6/h5-6H,1-4H2;(H2,1,2,3)(H2,4,5,6) | | InChIKey | MWFNQNPDUTULBC-UHFFFAOYSA-N | | SMILES | C1NCCNC1.O(P(O)(O)=O)P(O)(O)=O | | LogP | -1 at 20℃ | | EPA Substance Registry System | Diphosphoric acid, compd. with piperazine (1:1) (66034-17-1) |
| | Diphosphoric acid compd. with-piperazine (1:1) Usage And Synthesis |
| Application | DIPHOSPHORIC ACID COMPD. WITH-PIPERAZINE (1:1) is a white or off-white crystalline powder. It has the characteristics of high char formation efficiency, good thermal stability, low smoke and non-toxicity, resistance to light aging, and low hygroscopicity. It can be used in flame-retardant products such as polypropylene (PP), polyethylene (PE), polyurethane (PU), acrylonitrile-butadiene-styrene (ABS), and epoxy resin (EP). It has huge potential for future market development. | | Flammability and Explosibility | Not classified |
| | Diphosphoric acid compd. with-piperazine (1:1) Preparation Products And Raw materials |
|