|
|
| | 3-Bromo-4-chloro-6-trifluoromethylquinoline Basic information |
| | 3-Bromo-4-chloro-6-trifluoromethylquinoline Chemical Properties |
| Boiling point | 308.2±37.0 °C(Predicted) | | density | 1.740±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -0.01±0.27(Predicted) | | form | solid | | Appearance | White to light yellow Solid | | InChI | 1S/C10H4BrClF3N/c11-7-4-16-8-2-1-5(10(13,14)15)3-6(8)9(7)12/h1-4H | | InChIKey | BNOPQFZALQIKEY-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc2ncc(Br)c(Cl)c2c1 |
| Hazard Codes | T | | Risk Statements | 25-36 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 3-Bromo-4-chloro-6-trifluoromethylquinoline Usage And Synthesis |
| | 3-Bromo-4-chloro-6-trifluoromethylquinoline Preparation Products And Raw materials |
|