|
|
| | Ethyl 1,3-dimethyl-1H-pyrazole-4-carboxylate Basic information |
| Product Name: | Ethyl 1,3-dimethyl-1H-pyrazole-4-carboxylate | | Synonyms: | ethyl 1,3-dimethylpyrazole-4-carboxylate;1,3-dimethyl-4-pyrazolecarboxylic acid ethyl ester;1,3-dimethylpyrazole-4-carboxylic acid ethyl ester;Ethyl 1,3-dimethyl-1H-pyrazole-4-carboxylate;1H-Pyrazole-4-carboxylic acid, 1,3-dimethyl-, ethyl ester;Ethyl 1,3-dimethyl-1H-pyrazol-4-carboxylate;1,3-dimethyl-1H-pyrazole-4-ethyl carboxylate | | CAS: | 85290-76-2 | | MF: | C8H12N2O2 | | MW: | 168.19 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 85290-76-2.mol |  |
| | Ethyl 1,3-dimethyl-1H-pyrazole-4-carboxylate Chemical Properties |
| Melting point | 58-59 °C | | Boiling point | 85-86 °C(Press: 0.1 Torr) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 0.58±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C8H12N2O2/c1-4-12-8(11)7-5-10(3)9-6(7)2/h5H,4H2,1-3H3 | | InChIKey | UEOAHNKIDQAFPD-UHFFFAOYSA-N | | SMILES | N1(C)C=C(C(OCC)=O)C(C)=N1 |
| HazardClass | IRRITANT | | HS Code | 2933199090 |
| | Ethyl 1,3-dimethyl-1H-pyrazole-4-carboxylate Usage And Synthesis |
| | Ethyl 1,3-dimethyl-1H-pyrazole-4-carboxylate Preparation Products And Raw materials |
|