|
|
| | 1-Bromo-4-(1-trifluoromethyl-cyclopropyl)-benzene Basic information |
| | 1-Bromo-4-(1-trifluoromethyl-cyclopropyl)-benzene Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C10H8BrF3/c11-8-3-1-7(2-4-8)9(5-6-9)10(12,13)14/h1-4H,5-6H2 | | InChIKey | LJOJKFHNKMTEFS-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(C2(C(F)(F)F)CC2)C=C1 |
| | 1-Bromo-4-(1-trifluoromethyl-cyclopropyl)-benzene Usage And Synthesis |
| Uses | 1-Bromo-4-(1-(trifluoromethyl)cyclopropyl)benzene is used as a reactant in the synthesis of a potent, selective T-type calcium channel blocker as drug candidate for treatment of generalized epilepsies. |
| | 1-Bromo-4-(1-trifluoromethyl-cyclopropyl)-benzene Preparation Products And Raw materials |
|