- Famotidine Impurity F
-
- $0.00 / 10mg
-
2025-12-19
- CAS:107880-74-0
- Min. Order: 10mg
- Purity: 90%+
- Supply Ability: 10g
|
| | FaMotidine Acid IMpurity Basic information |
| | FaMotidine Acid IMpurity Chemical Properties |
| Melting point | 246-248°C | | Boiling point | 489.9±55.0 °C(Predicted) | | density | 1.63±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly, Heated) | | form | Solid | | pka | 4.29±0.10(Predicted) | | color | White to Yellow | | biological source | synthetic | | Stability: | Light Sensitive | | InChI | InChI=1S/C8H12N4O2S2/c9-7(10)12-8-11-5(4-16-8)3-15-2-1-6(13)14/h4H,1-3H2,(H,13,14)(H4,9,10,11,12) | | InChIKey | JEGZXDCDUSGFSB-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCSCC1=CSC(NC(N)=N)=N1 |
| | FaMotidine Acid IMpurity Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | An impurity of Famotidine (F102250(P)), which is a histamine H2-receptor antagonist and an antiulcerative. | | Uses | Famotidine impurity. | | Definition | ChEBI: Propanoic acid, 3-[[[2-[(aminoiminomethyl)amino]-4-thiazolyl]methyl]thio]- is a member of thiazoles. |
| | FaMotidine Acid IMpurity Preparation Products And Raw materials |
|