|
|
| | 2-(5-Bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | 2-(5-Bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | 2-(5-Bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;5-Bromo-2-methylphenylboronic acid pinacol ester;1,3,2-Dioxaborolane, 2-(5-bromo-2-methylphenyl)-4,4,5,5-tetramethyl- | | CAS: | 1192051-39-0 | | MF: | C13H18BBrO2 | | MW: | 297 | | EINECS: | | | Product Categories: | | | Mol File: | 1192051-39-0.mol |  |
| | 2-(5-Bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Melting point | 69-70℃ | | Boiling point | 364℃ | | density | 1.26 | | Fp | 168℃ | | storage temp. | 2-8°C | | InChI | InChI=1S/C13H18BBrO2/c1-9-6-7-10(15)8-11(9)14-16-12(2,3)13(4,5)17-14/h6-8H,1-5H3 | | InChIKey | CIFYKKUUTOSOIK-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1=CC(Br)=CC=C1C |
| | 2-(5-Bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| | 2-(5-Bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|