|
|
| | 4-iodo-2-Methylbenzoic acid Basic information |
| | 4-iodo-2-Methylbenzoic acid Chemical Properties |
| Melting point | 172 °C(Solv: water (7732-18-5)) | | Boiling point | 326.5±30.0 °C(Predicted) | | density | 1.867±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Base (Slightly), Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | pka | 3.70±0.25(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C8H7IO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) | | InChIKey | KISJQMPHSCFGKR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(I)C=C1C |
| | 4-iodo-2-Methylbenzoic acid Usage And Synthesis |
| Uses | 5-Iodotoluic Acid can be used as 15-PGDH inhibitor to prevent and treat 15-PGDH-related diseases, for instance, fibrosis, inflammation, cardiovascular disease, wound, and auto-immune diseases. |
| | 4-iodo-2-Methylbenzoic acid Preparation Products And Raw materials |
|