|
|
| | ethyl 2-[(1E)-cyclopropylidene]acetate Basic information |
| Product Name: | ethyl 2-[(1E)-cyclopropylidene]acetate | | Synonyms: | ethyl 2-[(1E)-cyclopropylidene]acetate;Aceticacid, 2-cyclopropylidene-, ethyl ester;2-cyclopropylideneAcetic acid Ethyl ester;Ethyl cyclopropylideneacetate;Cyclopropylideneacetic acid ethyl ester;N-{3-[(5-CHLORO-2-{[4-(4-METHYL-1-PIPERAZINYL)PHENYL]AMINO}-4-PYRIMIDINYL)OXY]PHENYL}ACRYLAMIDE;ethyl 2-cyclopropylideneacetate;2-Cyclopropylidene-acetic acid ethyl este | | CAS: | 74592-36-2 | | MF: | C7H10O2 | | MW: | 126.15 | | EINECS: | | | Product Categories: | | | Mol File: | 74592-36-2.mol | ![ethyl 2-[(1E)-cyclopropylidene]acetate Structure](CAS/20150408/GIF/74592-36-2.gif) |
| | ethyl 2-[(1E)-cyclopropylidene]acetate Chemical Properties |
| Boiling point | 78-82 °C(Press: 1 Torr) | | density | 1.179±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H10O2/c1-2-9-7(8)5-6-3-4-6/h5H,2-4H2,1H3 | | InChIKey | CINXGNHRKLMYRK-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)/C=C1/CC/1 |
| | ethyl 2-[(1E)-cyclopropylidene]acetate Usage And Synthesis |
| Uses | Ethyl 2-cyclopropylideneacetate is used as a reactant in the regio- and stereoselective palladium- and platinum-catalyzed silaboration of methylenecyclopropanes with dioxaborolane. |
| | ethyl 2-[(1E)-cyclopropylidene]acetate Preparation Products And Raw materials |
|