|
|
| | Methyl 4-ethyl-3-iodobenzoate Basic information |
| Product Name: | Methyl 4-ethyl-3-iodobenzoate | | Synonyms: | Methyl 4-ethyl-3-iodbenzoate;Methyl 4-ethyl-3-iodo-benzoate;Methyl 4-Ethyl-iodobenzoate;4-Ethyl-3-iodo-benzoic acid Methyl ester;Benzoic acid, 4-ethyl-3-iodo-, methyl ester;Benzoic acid, 4-ethyl-3-iodo-, methyl ester (9CI, ACI);4-ethyl-3-iodo-Benzoic acid methyl ester (9CI ACI);Methyl 4-ethyl-3-iodobenzoatevvvvvv | | CAS: | 51885-91-7 | | MF: | C10H11IO2 | | MW: | 290.1 | | EINECS: | | | Product Categories: | | | Mol File: | 51885-91-7.mol |  |
| | Methyl 4-ethyl-3-iodobenzoate Chemical Properties |
| Boiling point | 326.914±35.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.592±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C(protect from light) | | InChI | InChI=1S/C10H11IO2/c1-3-7-4-5-8(6-9(7)11)10(12)13-2/h4-6H,3H2,1-2H3 | | InChIKey | JTKHZRNJWHCKFS-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(CC)C(I)=C1 |
| | Methyl 4-ethyl-3-iodobenzoate Usage And Synthesis |
| Uses | Methyl 4-Ethyl-iodobenzoate is used in the preparation of DDR1 (Discoidin Domain Receptor 1) inhibitors. Inhibitor in the proliferation of cancer cells exhibiting high levels of DDR1. Also used in the synthesis of GZD824, an inhibitor used in the treatment of chronic myelogenous leukemia. |
| | Methyl 4-ethyl-3-iodobenzoate Preparation Products And Raw materials |
|