| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Matrix Scientific |
| Tel: |
803 788-9494 All other calls |
| Email: |
sales@matrixscientific.com |
|
| | 5-[2-Fluoro-5-(trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid Basic information |
| | 5-[2-Fluoro-5-(trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid Chemical Properties |
| Boiling point | 367.3±42.0 °C(Predicted) | | density | 1.536±0.06 g/cm3(Predicted) | | pka | 2.87±0.10(Predicted) | | form | solid | | InChI | 1S/C12H6F4N2O3/c13-7-2-1-6(12(14,15)16)3-9(7)21-10-5-17-8(4-18-10)11(19)20/h1-5H,(H,19,20) | | InChIKey | AMHPTTMMIMBNNS-UHFFFAOYSA-N | | SMILES | FC(F)(C1=CC=C(F)C(OC2=NC=C(C(O)=O)N=C2)=C1)F |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 5-[2-Fluoro-5-(trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid Usage And Synthesis |
| | 5-[2-Fluoro-5-(trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid Preparation Products And Raw materials |
|