| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2-Oxo-3-hydroxy-LSD (2-Oxo-3-hydroxy-lysergic acid diethylamide) Basic information |
| Product Name: | 2-Oxo-3-hydroxy-LSD (2-Oxo-3-hydroxy-lysergic acid diethylamide) | | Synonyms: | 2-Oxo-3-hydroxy-LSD (2-Oxo-3-hydroxy-lysergic acid diethylamide);(8β)-9,10-Didehydro-N,N-diethyl-2,3-dihydro-3-hydroxy-6-Methyl-2-oxoergoline-8-carboxaMide;N,N-Diethyl-2,3-dihydro-3-hydroxy-2-oxo-lysergaMide;2-Oxo-3-hydroxy-LSD solution;2-Oxo-3-hydroxy-lysergic acid diethylamide solution;(6aR,9R)-N,N-diethyl-5a-hydroxy-7-methyl-5-oxo-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl-2,3-dihydro-3-hydroxy-6-methyl-2-oxo-, (8β)-;2,3-Dihydro-3-hydroxy-2-oxo Lysergide (100 μg/mL in Acetonitrile) | | CAS: | 111295-09-1 | | MF: | C20H25N3O3 | | MW: | 355.4308 | | EINECS: | 200-835-2 | | Product Categories: | Amines;Heterocycles;Intermediates & Fine Chemicals;Neurochemicals;Pharmaceuticals | | Mol File: | 111295-09-1.mol |  |
| | 2-Oxo-3-hydroxy-LSD (2-Oxo-3-hydroxy-lysergic acid diethylamide) Chemical Properties |
| Fp | 2℃ | | storage temp. | -20°C | | solubility | soluble in Acetonitrile | | form | Pale Yellow to Light Yellow Solution | | Major Application | forensics and toxicology | | InChI | 1S/C20H25N3O3/c1-4-23(5-2)18(24)12-9-14-13-7-6-8-15-17(13)20(26,19(25)21-15)10-16(14)22(3)11-12/h6-9,12,16,26H,4-5,10-11H2,1-3H3,(H,21,25)/t12-,16-,20/m1/s1 | | InChIKey | YSZSHHCNLVHCNV-VRORWYBRSA-N | | SMILES | CCN(CC)C(=O)[C@H]1CN(C)[C@@H]2CC3(O)C(=O)Nc4cccc(C2=C1)c34 |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36 | | Safety Statements | 16-36/37 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | 2-Oxo-3-hydroxy-LSD (2-Oxo-3-hydroxy-lysergic acid diethylamide) Usage And Synthesis |
| Uses | 2,3-Dihydro-3-hydroxy-2-oxo Lysergide is a major metabolite of Lysergide (L488010). Controlled Substance. | | General Description | 2-Oxo-3-hydroxy-LSD is a major urinary metabolite of lysergic acid diethyl amide, or LSD. This certified solution standard is suitable for use in LC/MS or GC/MS applications for clinical toxicology, forensic analysis, or urine drug testing. Known for its role in 1960′s American counterculture, LSD is one of the most potent psychedelic drugs ever created. |
| | 2-Oxo-3-hydroxy-LSD (2-Oxo-3-hydroxy-lysergic acid diethylamide) Preparation Products And Raw materials |
|