|
|
| | 4-Bromo-3,5-difluoroanisole Basic information |
| Product Name: | 4-Bromo-3,5-difluoroanisole | | Synonyms: | 4-Bromo-3,5-difluoroanisole 97%;2-bromo-1,3-difluoro-5-methoxybenzene;4-BROMO-3,5-DIFLUOROANISOLE: TECH., 85%;4-BROMO-3,5-DIFLUOROANISOLE;4-Bromo-3,5-difluoroanisole, mixture of isomers;4-Bromo-3,5-difluoroanisole,97%;4-BroMo-3;5-difluoroanisole | | CAS: | 202865-61-0 | | MF: | C7H5BrF2O | | MW: | 223.01 | | EINECS: | 679-553-0 | | Product Categories: | Anisole | | Mol File: | 202865-61-0.mol |  |
| | 4-Bromo-3,5-difluoroanisole Chemical Properties |
| Melting point | 26-30°C | | Boiling point | 176.5±35.0 °C(Predicted) | | density | 1.6402 (rough estimate) | | refractive index | 1.5225-1.5245 | | storage temp. | Sealed in dry,Room Temperature | | form | powder to lump | | color | White to Almost white | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C7H5BrF2O/c1-11-4-2-5(9)7(8)6(10)3-4/h2-3H,1H3 | | InChIKey | GEJMNTXYFBBTFH-UHFFFAOYSA-N | | SMILES | C1(F)=CC(OC)=CC(F)=C1Br | | CAS DataBase Reference | 202865-61-0(CAS DataBase Reference) |
| | 4-Bromo-3,5-difluoroanisole Usage And Synthesis |
| Chemical Properties | clear slightly yellow liquid or white crystalline | | Uses | It is used to prepare difluorophenacyl analogs as inhibitors of cyclin-dependent kinases. It is also used to synthesize aminopyridine N-oxides for selective inhibition of p38 MAP kinase. | | Uses | 4-Bromo-3,5-difluoroanisole is used to prepare difluorophenacyl analogs as inhibitors of cyclin-dependent kinases. It is also used to synthesize aminopyridine N-oxides for selective inhibition of p38 MAP kinase. |
| | 4-Bromo-3,5-difluoroanisole Preparation Products And Raw materials |
|