|
|
| | 1,1'-Bicyclohexyl,4-ethyl-4'-propyl-, (trans,trans)- Basic information |
| Product Name: | 1,1'-Bicyclohexyl,4-ethyl-4'-propyl-, (trans,trans)- | | Synonyms: | 4-ethyl-4`-propylbi(cyclohexane);1,1'-bicyclohexy,4-ethyl-4'-propyl(trans,trans);3HH2;1,1'-Bicyclohexyl, 4-ethyl-4'-propyl-;1,1'-Bicyclohexyl,4-ethyl-4'-propyl-, (trans,trans)-;(trans,trans)-4-Ethyl-4'-propyl-1,1'-bi(cyclohexane);trans,trans-4-Ethyl-4'-propylbicyclohexyl;Trans -4-propyl-4'-ethyl dicyclohexane | | CAS: | 96624-41-8 | | MF: | C17H32 | | MW: | 236.44 | | EINECS: | 619-230-3 | | Product Categories: | OLED | | Mol File: | 96624-41-8.mol |  |
| | 1,1'-Bicyclohexyl,4-ethyl-4'-propyl-, (trans,trans)- Chemical Properties |
| Boiling point | 311.4±9.0 °C(Predicted) | | density | 0.849±0.06 g/cm3 (20 ºC 760 Torr) | | vapor pressure | 0.024-0.57Pa at 20-50℃ | | InChI | InChI=1S/C17H32/c1-3-5-15-8-12-17(13-9-15)16-10-6-14(4-2)7-11-16/h14-17H,3-13H2,1-2H3/t14-,15-,16-,17- | | InChIKey | KORMYSCDCHFFMN-GARHLSDISA-N | | SMILES | [C@@H]1([C@@H]2CC[C@@H](CCC)CC2)CC[C@@H](CC)CC1 | | LogP | 8.2 |
| | 1,1'-Bicyclohexyl,4-ethyl-4'-propyl-, (trans,trans)- Usage And Synthesis |
| | 1,1'-Bicyclohexyl,4-ethyl-4'-propyl-, (trans,trans)- Preparation Products And Raw materials |
|