|
|
| | Bupropion HydrobroMide Basic information |
| Product Name: | Bupropion HydrobroMide | | Synonyms: | Bupropion HydrobroMide;2-(tert-Butylamino)-1-(3-chlorophenyl)propan-1-one hydrobromide;Bupropion Hydrobromide (1078846);Amfebutamone hydrobromide;Bupropion Impurity 43 | | CAS: | 905818-69-1 | | MF: | C13H19BrClNO | | MW: | 320.65306 | | EINECS: | | | Product Categories: | | | Mol File: | 905818-69-1.mol |  |
| | Bupropion HydrobroMide Chemical Properties |
| storage temp. | 2-30°C | | Major Application | pharmaceutical | | InChI | 1S/C13H18ClNO.BrH/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10;/h5-9,15H,1-4H3;1H | | InChIKey | WSTCENNATOVXKQ-UHFFFAOYSA-N | | SMILES | [Br-].Clc1cc(ccc1)C(=O)C([N+H2]C(C)(C)C)C |
| WGK Germany | WGK 3 | | HS Code | 2923900100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Bupropion HydrobroMide Usage And Synthesis |
| Uses | These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements. |
| | Bupropion HydrobroMide Preparation Products And Raw materials |
|