|
|
| | DODECAMETHYLPENTASILOXANE Basic information |
| Product Name: | DODECAMETHYLPENTASILOXANE | | Synonyms: | 1,1,1,3,3,5,5,7,7,9,9,9-Dodecamethylpentasiloxane;dodecamethyl-pentasiloxan;Pentasiloxane, dodecamethyl-;Dodecamethyl-2,4,6,8-tetraoxa-1,3,5,7,9-pentasilanonane;Dodecamethylnonanepentasiloxane;Penta(dimethylsiloxane);Dodecamethylpentasiloxane,97%;DODECAMETHYLPENTASILOXANE | | CAS: | 141-63-9 | | MF: | C12H36O4Si5 | | MW: | 384.84 | | EINECS: | 205-492-2 | | Product Categories: | Organics;Organometallic Reagents;Organosilicon;Siloxanes;Intermediates & Fine Chemicals;Pharmaceuticals;Chemical Synthesis;Organometallic Reagents | | Mol File: | 141-63-9.mol |  |
| | DODECAMETHYLPENTASILOXANE Chemical Properties |
| Melting point | -81 °C (lit.) | | Boiling point | 230 °C (lit.) | | density | 0.875 g/mL at 25 °C (lit.) | | vapor pressure | <1 mm Hg ( 20 °C) | | refractive index | n20/D 1.392(lit.) | | Fp | 187 °F | | storage temp. | Refrigerator | | solubility | Benzene (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | liquid | | Specific Gravity | 0.876 | | color | Colourless | | Water Solubility | 70.41ng/L at 23℃ | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | Merck | 14,3404 | | Dielectric constant | 2.5(20℃) | | Cosmetics Ingredients Functions | ANTIFOAMING | | InChI | 1S/C12H36O4Si5/c1-17(2,3)13-19(7,8)15-21(11,12)16-20(9,10)14-18(4,5)6/h1-12H3 | | InChIKey | FBZANXDWQAVSTQ-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C | | LogP | 9.411 at 25℃ | | CAS DataBase Reference | 141-63-9(CAS DataBase Reference) | | EPA Substance Registry System | Pentasiloxane, dodecamethyl- (141-63-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | RTECS | SB0970000 | | TSCA | TSCA listed | | HS Code | 2931.90.9010 | | Storage Class | 10 - Combustible liquids | | Hazardous Substances Data | 141-63-9(Hazardous Substances Data) | | Toxicity | guinea pig,LDLo,oral,50gm/kg (50000mg/kg),Journal of Industrial Hygiene and Toxicology. Vol. 30, Pg. 332, 1948. |
| | DODECAMETHYLPENTASILOXANE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | A non-cyclic polydimethyl siloxane. Study shows that it can be transformed by a specific microflora and in the natural environment degraded by mechanisms similar to other organic compounds. | | Uses | As a basis for silicone oils or fluids designed to withstand extremes of temperature; as a foam suppressant in petroleum lubricating oil. | | Definition | ChEBI: An organosiloxane that is pentasiloxane in which all the hydrogens have been replaced by methyl groups. Metabolite observed in cancer metabolism. | | Flammability and Explosibility | Non flammable | | Toxics Screening Level | The initial threshold screening level (ITSL) for dodecamethylpentasiloxane remains at 0.1 μg/m3 based on an annual averaging time. |
| | DODECAMETHYLPENTASILOXANE Preparation Products And Raw materials |
|