- Bis-Mal-amido-PEG3
-
- $0.00 / 500mg
-
2025-06-07
- CAS:1008402-47-8
- Min. Order: 500mg
- Purity: >98.00%
- Supply Ability: 500mg
|
| | Mal-PEG3-Mal Basic information |
| Product Name: | Mal-PEG3-Mal | | Synonyms: | Mal-PEG3-Mal;Bis-Mal-PEG3;1H-Pyrrole-1-propanamide, N,N'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)]bis[2,5-dihydro-2,5-dioxo-;Bis-Mal-amido-PEG3;MAL-PEG-MA;N,N'-(((oxybis(ethane-2,1-diyl))bis(oxy))bis(ethane-2,1-diyl))bis(3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamide) | | CAS: | 1008402-47-8 | | MF: | C22H30N4O9 | | MW: | 494.49 | | EINECS: | | | Product Categories: | Homobifunctional PEG;peg | | Mol File: | 1008402-47-8.mol |  |
| | Mal-PEG3-Mal Chemical Properties |
| Boiling point | 791.7±60.0 °C(Predicted) | | density | 1.319±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Very Slightly), DMSO (Slightly, Sonicated) | | form | Solid | | pka | 14.70±0.46(Predicted) | | color | Pale Yellow to Light Beige | | InChI | InChI=1S/C22H30N4O9/c27-17(5-9-25-19(29)1-2-20(25)30)23-7-11-33-13-15-35-16-14-34-12-8-24-18(28)6-10-26-21(31)3-4-22(26)32/h1-4H,5-16H2,(H,23,27)(H,24,28) | | InChIKey | KFEOJIBJOGJZDY-UHFFFAOYSA-N | | SMILES | O(CCOCCNC(=O)CCN1C(=O)C=CC1=O)CCOCCNC(=O)CCN1C(=O)C=CC1=O |
| | Mal-PEG3-Mal Usage And Synthesis |
| Description | Bis-Mal-PEG3 is a PEG linker containing a two maleimide groups. The maleimide groups will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | Bis-Mal-PEG3, is a PEG derivative containing a two maleimide groups. The maleimide groups will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. | | IC 50 | PEGs |
| | Mal-PEG3-Mal Preparation Products And Raw materials |
|