|
|
| | 1,1-DIMETHYLGUANIDINE SULFATE Basic information |
| | 1,1-DIMETHYLGUANIDINE SULFATE Chemical Properties |
| Melting point | 300 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | White to off-white | | BRN | 3916505 | | InChI | 1S/2C3H9N3.H2O4S/c2*1-6(2)3(4)5;1-5(2,3)4/h2*1-2H3,(H3,4,5);(H2,1,2,3,4) | | InChIKey | QSCHFHVDZCPIKX-UHFFFAOYSA-N | | SMILES | OS(O)(=O)=O.CN(C)C(N)=N.CN(C)C(N)=N | | CAS DataBase Reference | 598-65-2(CAS DataBase Reference) | | EPA Substance Registry System | Guanidine, N,N-dimethyl-, sulfate (2:1) (598-65-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 29252900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,1-DIMETHYLGUANIDINE SULFATE Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | 1,1-Dimethylguanidine sulfate salt has been employed:
- as peroxide activator for bleaching cellulosic textiles
- in the synthesis of N2,N2-dimethyl-4-(1-methyl-1H-indol-3-yl)pyrimidine-2,5-diamine, substrate for the modified Pictet-Spengler reaction
|
| | 1,1-DIMETHYLGUANIDINE SULFATE Preparation Products And Raw materials |
|