| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2,4-Dichlorophenoxyacetic acid sodium Basic information |
| | 2,4-Dichlorophenoxyacetic acid sodium Chemical Properties |
| solubility | H2O: soluble | | form | powder to crystal | | color | White to Light yellow to Light orange | | Water Solubility | H2O: soluble | | Major Application | agriculture | | InChI | 1S/C8H6Cl2O3.Na.H2O/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;;/h1-3H,4H2,(H,11,12);;1H2/q;+1;/p-1 | | InChIKey | LNSAEWXPCBLGDX-UHFFFAOYSA-M | | SMILES | O.[Na+].[O-]C(=O)COc1ccc(Cl)cc1Cl |
| Hazard Codes | Xn,N | | Risk Statements | 22-41-43-51/53 | | Safety Statements | 24/25-26-36/37/39-46-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Dam. 1
Skin Sens. 1A
STOT SE 3 |
| | 2,4-Dichlorophenoxyacetic acid sodium Usage And Synthesis |
| Uses | (2,4-Dichlorophenoxy)acetic Acid Sodium Salt Monohydrate is a synthetic auxin (plant hormone) used in plant cell culture media and as a herbicide. |
| | 2,4-Dichlorophenoxyacetic acid sodium Preparation Products And Raw materials |
|