|
|
| | 2-Deschloro Aripiprazole Basic information |
| | 2-Deschloro Aripiprazole Chemical Properties |
| Melting point | 100-102°C | | Boiling point | 626.9±55.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.42±0.20(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | InChI=1S/C23H28ClN3O2/c24-19-4-3-5-20(16-19)27-13-11-26(12-14-27)10-1-2-15-29-21-8-6-18-7-9-23(28)25-22(18)17-21/h3-6,8,16-17H,1-2,7,9-15H2,(H,25,28) | | InChIKey | SHHUSQIOAKPGMO-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(OCCCCN3CCN(C4=CC=CC(Cl)=C4)CC3)=C2)CCC1=O |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 |
| | 2-Deschloro Aripiprazole Usage And Synthesis |
| Uses | 2-Deschloro Aripiprazole is an impurity of the antipsychotic agent Aripiprazole (A771000). Aripiprazole impurity B. | | Uses | 2-Deschloro Aripiprazole (Aripiprazole EP Impurity D) is an impurity of the antipsychotic agent Aripiprazole (A771000). Aripiprazole impurity B. |
| | 2-Deschloro Aripiprazole Preparation Products And Raw materials |
|