|
|
| | 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diMethyl ester Basic information |
| Product Name: | 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diMethyl ester | | Synonyms: | 2,5-Dihydroxybenzol-1,4-dicarbonsaeure-dimethylester;1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diMethyl ester;dimethyl 2,5-dihydroxybenzene-1,4-dicarboxylate;1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, 1,4-dimethyl ester;2,5-dihydroxyparabenzenedimacetic acidimethyl ester | | CAS: | 5870-37-1 | | MF: | C10H10O6 | | MW: | 226.18 | | EINECS: | 807-699-9 | | Product Categories: | | | Mol File: | 5870-37-1.mol |  |
| | 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diMethyl ester Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen | | Appearance | Light yellow to green yellow Solid | | InChI | InChI=1S/C10H10O6/c1-15-9(13)5-3-8(12)6(4-7(5)11)10(14)16-2/h3-4,11-12H,1-2H3 | | InChIKey | WABMHCVYKWKAAH-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=CC(O)=C(C(OC)=O)C=C1O |
| | 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diMethyl ester Usage And Synthesis |
| | 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diMethyl ester Preparation Products And Raw materials |
|