|
|
| | rac-Febrifugine Dihydrochloride Basic information |
| Product Name: | rac-Febrifugine Dihydrochloride | | Synonyms: | rac-Febrifugine Dihydrochloride;3-[3-[(2R,3S)-3-Hydroxy-2-piperidinyl]-2-oxopropyl]-4(3H)-quinazolinone dihydrochloride;Atensil;ISF-2123;Pildralazine dihydrochloride;Propyldazine hydrochloride;Inhibitor,Parasite,Febrifugine dihydrochloride,antimalarial,alkaloid,Quinazolinone,inhibit,Febrifugine;Febrifugine (hydrochloride) | | CAS: | 32434-42-7 | | MF: | C16H19N3O3 | | MW: | 301.34036 | | EINECS: | | | Product Categories: | Aromatics, Intermediates | | Mol File: | 32434-42-7.mol |  |
| | rac-Febrifugine Dihydrochloride Chemical Properties |
| Melting point | 220-222 °C (decomp) | | storage temp. | -20°C | | solubility | H2O: soluble15mg/mL, clear | | form | powder | | color | off-white to gray to brown | | Optical Rotation | [α]/D 10 to 15°, c = 1 in H2O | | Water Solubility | H2O: 15mg/mL, clear | | InChI | 1S/C17H20N2O3.CH4/c20-13(9-12-5-1-4-8-16(12)21)10-19-11-18-15-7-3-2-6-14(15)17(19)22;/h2-3,6-7,11-12,16,21H,1,4-5,8-10H2;1H4/t12-,16+;/m1./s1 | | InChIKey | SNTOTCUGCWLHEZ-KKJWGQAZSA-N | | SMILES | O=C1C2=CC=CC=C2N=CN1CC(C[C@@H]3[C@@H](O)CCCC3)=O.C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | rac-Febrifugine Dihydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | rac-Febrifugine dihydrochloride is the salt of Febrifugine, a bioactive constituent of a Chinese medicinal herb that is characterized by its therapeutic activity regarding malaria, cancer, fibrosis and inflammatory diseases. | | Biochem/physiol Actions | Febrifugine dihydrochloride exhibits strong antimalarial activity against Plasmodium falciparum, the most insidious malaria causative agent. The adverse effects of febrifugine include diarrhoea, vomiting and liver toxicity. | | IC 50 | Plasmodium |
| | rac-Febrifugine Dihydrochloride Preparation Products And Raw materials |
|