|
|
| | APIGENIN-7-GLUCURONIDE Basic information |
| Product Name: | APIGENIN-7-GLUCURONIDE | | Synonyms: | APIGENIN-7-GLUCURONIDE;4',5-Dihydroxy-7-[(β-D-glucopyranuronosyl)oxy]flavone;5,4'-Dihydroxy-7-(β-D-glucopyranuronosyloxy)flavone;7-(6-Oxo-β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;Apigenin 7-O-β-D-glucuronide;Glucuronyl-7-apigenin;Apigenin 7-glucuronide(Apigenin-7-O-β-D-glucuronide);5-Hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl beta-D-Glucuronide | | CAS: | 29741-09-1 | | MF: | C21H18O11 | | MW: | 446.36 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 29741-09-1.mol |  |
| | APIGENIN-7-GLUCURONIDE Chemical Properties |
| Melting point | >300℃ | | Boiling point | 841.8±65.0 °C(Predicted) | | density | 1.737 | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO : 65 mg/mL (145.62 mM; Need ultrasonic) | | form | powder | | pka | 2.73±0.70(Predicted) | | color | Yellowish | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | Cosmetics Ingredients Functions | ANTIOXIDANT
SKIN PROTECTING
HAIR CONDITIONING
SKIN CONDITIONING - HUMECTANT | | InChIKey | JBFOLLJCGUCDQP-ZFORQUDYSA-N | | SMILES | C12C=C(C(O)=CC=1C(=O)C=C(C1=CC=C(O)C=C1)O2)O[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](C(=O)O)O1)O |&1:20,21,23,24,26,r| |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | APIGENIN-7-GLUCURONIDE Usage And Synthesis |
| Chemical Properties | Yellow powder, soluble in organic solvents such as methanol, ethanol, DMSO, etc., derived from Scutellaria barbata, Erigeron breviscapus, and Erigeron chinensis. | | Uses | Apigenin 7-Glucuronide is a metabolite of Apigenin, which induces the reversion of transformed phenotypes of v-H-ras-transformed NIH 3T3 cells at low concentration (12.5 uM) by inhibiting MAP kinase activity. Also inhibits the proliferation of malignant tumor cells by G2/M arrest and induces morphological differentiation. Apigenin has also been reported to enhance the gap juntion intracellular communication in liver cells. | | Definition | ChEBI: Apigenin 7-glucuronide is a member of flavonoids and a glucosiduronic acid. | | target | NO | PGE | TNF-α | NOS | COX | AP-1 | ERK | p38MAPK | MMP-3 | MMP-8 | MMP-9 | MMP-13 | | IC 50 | MMP-3: 12.87 μM (IC50); MMP-8: 22.39 μM (IC50); MMP-9: 17.52 μM (IC50); MMP13: 0.27 μM (IC50) |
| | APIGENIN-7-GLUCURONIDE Preparation Products And Raw materials |
|