| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | 3-Phenyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-5-amine Basic information |
| | 3-Phenyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-5-amine Chemical Properties |
| form | solid | | InChI | 1S/C11H10F3N3/c12-11(13,14)7-17-10(15)6-9(16-17)8-4-2-1-3-5-8/h1-6H,7,15H2 | | InChIKey | GRUVVUBNDUYJAU-UHFFFAOYSA-N | | SMILES | FC(F)(CN1N=C(C2=CC=CC=C2)C=C1N)F |
| WGK Germany | WGK 3 | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1 Eye Irrit. 2 |
| | 3-Phenyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-5-amine Usage And Synthesis |
| | 3-Phenyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-5-amine Preparation Products And Raw materials |
|