|
|
| | Phenethicillin Sodium Salt Basic information |
| | Phenethicillin Sodium Salt Chemical Properties |
| Melting point | 180 - 183oC | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | InChIKey | HZRQUJWXQAEVBK-XHVSTOPPNA-M | | SMILES | [C@H]1(NC(=O)C(Oc2ccccc2)C)C2SC(C)(C)[C@H](C([O-])=O)N2C1=O.[Na+] |&1:0,18,r| |
| | Phenethicillin Sodium Salt Usage And Synthesis |
| Uses | Phenethicillin Sodium Salt is a semisynthetic penicillin based β-lactam antibiotic and are used in the treatment of bacterial infections caused by susceptible, usually Gram-positive bacteria. | | Uses | Phenethicillin is a semisynthetic penicillin based β-lactam antibiotic and are used in the treatment of bacterial infections caused by susceptible, usually Gram-positive bacteria. |
| | Phenethicillin Sodium Salt Preparation Products And Raw materials |
|