|
|
| | Zinc difluoroMethanesulfinate Basic information |
| Product Name: | Zinc difluoroMethanesulfinate | | Synonyms: | Zinc difluoroMethanesulfinate 95%;1,1-difluoro-methanesulfinic acid zinc salt (2:1);Baran difluoromethylation reagent;Bis(((difluoromethyl)sulfinyl)oxy)zinc;DFMS;Zinc difluoromethanesulfinate;Zincdifluoromethanesulphinate;Zinc Difluoromethanesulfinate (Contains up to 1 equiv. of Zinc Chloride) | | CAS: | 1355729-38-2 | | MF: | CH2F2O2SZn | | MW: | 181.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1355729-38-2.mol |  |
| | Zinc difluoroMethanesulfinate Chemical Properties |
| Melting point | 126 - 129°C | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/CH2F2O2S.Zn/c2-1(3)6(4)5;/h1H,(H,4,5); | | InChIKey | RQZULCLQVHAIAM-UHFFFAOYSA-N | | SMILES | C(F)(F)S(O)=O.[Zn] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Zinc difluoroMethanesulfinate Usage And Synthesis |
| Uses | Zinc Difluoromethanesulfinate (CAS# 1355729-38-2) is a useful compound for the preparation of phenylethynes as NF-κB inhibitors. | | General Description | Material is complexed with up to 1 equivalent of ZnCl2 | | reaction suitability | reaction type: C-C Bond Formation
reaction type: Fluorinations
reagent type: catalyst
reaction type: C-H Activation
reagent type: diversification reagent |
| | Zinc difluoroMethanesulfinate Preparation Products And Raw materials |
|