| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 3,6-DiMethyl-fluorene Basic information |
| | 3,6-DiMethyl-fluorene Chemical Properties |
| Melting point | 124-126°C | | Boiling point | 327.6±22.0 °C(Predicted) | | density | 1.074±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C15H14/c1-10-3-5-12-9-13-6-4-11(2)8-15(13)14(12)7-10/h3-8H,9H2,1-2H3 | | InChIKey | KKTCFZXZGSLKNV-UHFFFAOYSA-N | | SMILES | C1C2=C(C=C(C)C=C2)C2=C1C=CC(C)=C2 |
| | 3,6-DiMethyl-fluorene Usage And Synthesis |
| Uses | 3,6-Dimethyl-fluorene is a polymer composition for electroluminescent device. |
| | 3,6-DiMethyl-fluorene Preparation Products And Raw materials |
|