|
|
| | 1-Methyl-1H-pyrazol-3(2H)-one Basic information |
| Product Name: | 1-Methyl-1H-pyrazol-3(2H)-one | | Synonyms: | 1-Methyl-1H-pyrazol-3(2H);3-Hydroxy-1-methylpyrazole;EOS-62072;1-METHYL-1H-PYRAZOL-3-OL(WX900134);1-methyl-2,3-dihydro-1H-pyrazol-3-one;1-Methylpyrazol-3(2H)-one;3H-Pyrazol-3-one, 1,2-dihydro-1-methyl-;1-methyl-3-hydroxypyrazole | | CAS: | 52867-35-3 | | MF: | C4H6N2O | | MW: | 98.1 | | EINECS: | | | Product Categories: | | | Mol File: | 52867-35-3.mol |  |
| | 1-Methyl-1H-pyrazol-3(2H)-one Chemical Properties |
| Melting point | 124-128°C | | density | 1.146±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 8.98±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H6N2O/c1-6-3-2-4(7)5-6/h2-3H,1H3,(H,5,7) | | InChIKey | WIISOYLZJJYTHT-UHFFFAOYSA-N | | SMILES | N1(C)C=CC(=O)N1 |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 1-Methyl-1H-pyrazol-3(2H)-one Usage And Synthesis |
| Synthesis | Example 7: General procedure for the synthesis of 1-methyl-1H-pyrazol-3(2H)-one from methyl 3-methoxyacrylate and monomethylhydrazine. In a 250 mL flask, 70 g of methanol and 60.5 g (0.46 mol) of 35% concentration of monomethylhydrazine aqueous solution were first added and the reaction temperature was kept at 25 °C. Subsequently, 47.8 g (0.40 mol) of methyl 3-methoxyacrylate was slowly added dropwise over 25 min. The pH of the reaction mixture was maintained at 12 by parallel dropwise addition of a 17% concentration of aqueous NaOH solution during the dropwise addition and during subsequent stirring for 6 h. A total of 97.5 g of NaOH solution was consumed for this process. The yield of the target product 1-methyl-1H-pyrazol-3(2H)-one was 75% when the reaction reached 100% conversion. The ratio of 3-hydroxy isomer to 5-hydroxy isomer in the product was ≥15:1. | | References | [1] Patent: US6392058, 2002, B1 |
| | 1-Methyl-1H-pyrazol-3(2H)-one Preparation Products And Raw materials |
|