|
|
| | Perovskite CH3NH3PbBr3 Powder Basic information |
| Product Name: | Perovskite CH3NH3PbBr3 Powder | | Synonyms: | CH3NH3PbBr3;Perovskite CH3NH3PbBr3 Powder;Methylammonium tribromoplumbate;CH3NH3PbBr3 (MAPbBr3);methylammonium tribromoplumbate(II);Perovskite CH3NH3PbBr3 Powder, >99%;MAPbBr3;Methylammonium Lead Bromide | | CAS: | 69276-13-7 | | MF: | CH9Br3NPb | | MW: | 482 | | EINECS: | | | Product Categories: | | | Mol File: | 69276-13-7.mol |  |
| | Perovskite CH3NH3PbBr3 Powder Chemical Properties |
| form | Orange Crystals or Powders | | InChI | InChI=1S/CH5N.3BrH.Pb/c1-2;;;;/h2H2,1H3;3*1H;/q;;;;+2/p-2 | | InChIKey | WYGRLVBNZYDYSL-UHFFFAOYSA-L | | SMILES | CN.[Pb+2]([Br-])([Br-])[Br-].[H+] |
| | Perovskite CH3NH3PbBr3 Powder Usage And Synthesis |
| Application | Methylamine bromide perovskite has excellent photoelectric properties: high light absorption coefficient, large carrier mobility, long carrier lifetime and large scattering length, etc. It has great applications in optoelectronic fields such as solar cells, light-emitting diodes, photodetectors and laser emitters. | | Advantages |
Perovskite CH3NH3PbBr3 Powder has the advantages for:
High absorption coefficient; Better photostability; Higher thermal stability; Better external quantum efficiency.
|
| | Perovskite CH3NH3PbBr3 Powder Preparation Products And Raw materials |
|