|
|
| | (5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone Basic information |
| Product Name: | (5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone | | Synonyms: | (5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone;Methanone, [5-Bromo-2-Chloro-phenyl](4-Fluoro Phenyl);Bromo fuloro benzone;(5-bromo-2-chlorobenyl)(4-fluorophenyl)methanone;Empagliflozin-21;915085-85-1;Empagliflozin impurity 24/(5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone;Empagliflozin Impurity 72 | | CAS: | 915095-85-1 | | MF: | C13H7BrClFO | | MW: | 313.55 | | EINECS: | | | Product Categories: | 915095-85-1 | | Mol File: | 915095-85-1.mol |  |
| | (5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone Chemical Properties |
| Boiling point | 390.6±37.0 °C(Predicted) | | density | 1.568±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H7BrClFO/c14-9-3-6-12(15)11(7-9)13(17)8-1-4-10(16)5-2-8/h1-7H | | InChIKey | LVILQFKAGQFQEK-UHFFFAOYSA-N | | SMILES | C(C1=CC(Br)=CC=C1Cl)(C1=CC=C(F)C=C1)=O |
| | (5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone Usage And Synthesis |
| Uses | (5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone is an important pharmaceutical intermediate of Empagliflozin. |
| | (5-bromo-2-chlorophenyl)(4-fluorophenyl)methanone Preparation Products And Raw materials |
|