|
|
| | 5-(trifluoromethyl)-3-Isoxazolecarboxylic acid Basic information |
| Product Name: | 5-(trifluoromethyl)-3-Isoxazolecarboxylic acid | | Synonyms: | 5-(trifluoromethyl)-3-Isoxazolecarboxylic acid;5-(trifluoromethyl)isoxazole-3-carboxylic acid;5-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid;3-Isoxazolecarboxylic acid, 5-(trifluoromethyl)-;5-(trifluoromethyl)-1,2-oxazol-3-carboxylic? acid | | CAS: | 625120-14-1 | | MF: | C5H2F3NO3 | | MW: | 181.07 | | EINECS: | | | Product Categories: | | | Mol File: | 625120-14-1.mol |  |
| | 5-(trifluoromethyl)-3-Isoxazolecarboxylic acid Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H2F3NO3/c6-5(7,8)3-1-2(4(10)11)9-12-3/h1H,(H,10,11) | | InChIKey | GOSXXFNPBKFTNN-UHFFFAOYSA-N | | SMILES | O1C(C(F)(F)F)=CC(C(O)=O)=N1 |
| | 5-(trifluoromethyl)-3-Isoxazolecarboxylic acid Usage And Synthesis |
| | 5-(trifluoromethyl)-3-Isoxazolecarboxylic acid Preparation Products And Raw materials |
|