| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:116-9e
CAS:831217-43-7
Purity:>=98% (HPLC), powder Package:25MG Remarks:E1036-25MG
|
|
| | 1(2H)-PyriMidinehexanoic acid, 4-[1,1'-biphenyl]-4-yl-3,4-dihydro-6-Methyl-2-oxo-5-[(phenylMethoxy)carbonyl]- Basic information |
| Product Name: | 1(2H)-PyriMidinehexanoic acid, 4-[1,1'-biphenyl]-4-yl-3,4-dihydro-6-Methyl-2-oxo-5-[(phenylMethoxy)carbonyl]- | | Synonyms: | 4-[1,1′-Biphenyl]-4-yl-3,4-dihydro-6-methyl-2-oxo-5-[(phenylmethoxy)carbonyl]-1(2H)-pyrimidinehexanoic acid;116-9e;6-(4-([1,1'-biphenyl]-4-yl)-5-((benzyloxy)carbonyl)
-6-methyl-2-oxo-3,4-dihydropyrimidin-1(2H)-yl)hexanoic acid;1(2H)-PyriMidinehexanoic acid, 4-[1,1'-biphenyl]-4-yl-3,4-dihydro-6-Methyl-2-oxo-5-[(phenylMethoxy)carbonyl]-;116-9e >=98% (HPLC), powder;116 9e,1169e;6-(4-([1,1'-Biphenyl]-4-yl)-5-((benzyloxy)carbonyl)-6-methyl-2-oxo-3,4-dihydropyrimidin-1(2H)-yl)hexanoic acid;116-9e, 10 mM in DMSO | | CAS: | 831217-43-7 | | MF: | C31H32N2O5 | | MW: | 512.6 | | EINECS: | | | Product Categories: | | | Mol File: | 831217-43-7.mol | ![1(2H)-PyriMidinehexanoic acid, 4-[1,1'-biphenyl]-4-yl-3,4-dihydro-6-Methyl-2-oxo-5-[(phenylMethoxy)carbonyl]- Structure](CAS/20150408/GIF/831217-43-7.gif) |
| | 1(2H)-PyriMidinehexanoic acid, 4-[1,1'-biphenyl]-4-yl-3,4-dihydro-6-Methyl-2-oxo-5-[(phenylMethoxy)carbonyl]- Chemical Properties |
| Boiling point | 747.3±60.0 °C(Predicted) | | density | 1.205±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >20mg/mL | | pka | 4.76±0.10(Predicted) | | form | powder | | color | white to off-white | | InChIKey | GHFQWLNXJMUCGC-UHFFFAOYSA-N | | SMILES | CC1=C(C(NC(=O)N1CCCCCC(O)=O)c2ccc(cc2)-c3ccccc3)C(=O)OCc4ccccc4 |
| Hazard Codes | T,N | | Risk Statements | 25-50/53 | | Safety Statements | 45-60-61 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible, acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | 1(2H)-PyriMidinehexanoic acid, 4-[1,1'-biphenyl]-4-yl-3,4-dihydro-6-Methyl-2-oxo-5-[(phenylMethoxy)carbonyl]- Usage And Synthesis |
| Uses | 116-9e has been used as an inhibitor of heat shock protein 70 (Hsp70) co-chaperone HDJ2 (human Ydj1/DNAJA1) to study the influence of HDJ2 on the regulation of ribonucleotide reductase (RNR) activity in HEK293 cells. It has also been used as an Hsp70 inhibitor to study the effect of Hsp70 chaperone on b5‐ops glycosylation in the side populations (SP) HeLa cells. | | Biochem/physiol Actions | 116-9e is a dihhydropyrimidine compound. |
| | 1(2H)-PyriMidinehexanoic acid, 4-[1,1'-biphenyl]-4-yl-3,4-dihydro-6-Methyl-2-oxo-5-[(phenylMethoxy)carbonyl]- Preparation Products And Raw materials |
|