| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Thiamine-[13C4].Hydrochloride Basic information |
| Product Name: | Thiamine-[13C4].Hydrochloride | | Synonyms: | Thiamine-[13C4].Hydrochloride;Vitamin B1-[13C4] hydrochloride;Aneurine-[13C4] hydrochloride;Thiamine-(4-methyl-13C-thiazol-5-yl-13C3) hydrochloride 99 atom % 13C, 98% (CP);Thiamine-[13C4].Hydrochloride(Vitamin B1-[13C4]);Vitamin B1 hydrochloride salt;13C4]-Thiamine hydrochloride;Thiamine-(4-methyl-13C-thiazol-5-yl-13C?) hydrochloride | | CAS: | 1257525-77-1 | | MF: | C12H17N4OS.ClH.Cl | | MW: | 341.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1257525-77-1.mol | ![Thiamine-[13C4].Hydrochloride Structure](CAS/20180703/GIF/1257525-77-1.gif) |
| | Thiamine-[13C4].Hydrochloride Chemical Properties |
| Melting point | 250 °C (dec) (lit.) | | storage temp. | -20°C | | form | powder | | color | white | | InChI | InChI=1S/C12H17N4OS.2ClH/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);2*1H/q+1;;/p-1/i6+1,7+1,10+1,12+1;; | | InChIKey | DPJRMOMPQZCRJU-DBRYMKMKSA-M | | SMILES | OCCC1=C(C)[N+](=[13CH]S1)[13CH2][13C]1C=NC(=N[13C]=1N)C.[Cl-].[H]Cl |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Thiamine-[13C4].Hydrochloride Usage And Synthesis |
| Uses | Thiamine-(4-methyl-13C-thiazol-5-yl-13C3) hydrochloride is also known as vitamin B1(4-methyl-13C-thiazol-5-yl-13C3) hydrochloride. It can be used as a stable isotope internal standard for accurate data interpretation in specific biological samples by mass spectrometry (MS). |
| | Thiamine-[13C4].Hydrochloride Preparation Products And Raw materials |
|