|
|
| | 9-Hydroxy-3-aza-spiro[5.5]undecane-3-carboxylic acid tert-butyl ester Basic information |
| Product Name: | 9-Hydroxy-3-aza-spiro[5.5]undecane-3-carboxylic acid tert-butyl ester | | Synonyms: | 9-Hydroxy-3-aza-spiro[5.5]undecane-3-carboxylic acid tert-butyl ester;3-Azaspiro[5.5]undecane-3-carboxylic acid, 9-hydroxy-, 1,1-dimethylethyl ester;tert-butyl 9-hydroxy-3-azaspiro[5.5]undecane-3-carboxylate;3-BOC-9-HYDROXY-3-AZASPIRO[5.5]UNDECANE;tert-butyl 9-hydroxy-3-azaspiro[5.5]undecane-3-carboxylate - [B26501] | | CAS: | 918644-73-2 | | MF: | C15H27NO3 | | MW: | 269.38 | | EINECS: | | | Product Categories: | | | Mol File: | 918644-73-2.mol | ![9-Hydroxy-3-aza-spiro[5.5]undecane-3-carboxylic acid tert-butyl ester Structure](CAS/20180703/GIF/918644-73-2.gif) |
| | 9-Hydroxy-3-aza-spiro[5.5]undecane-3-carboxylic acid tert-butyl ester Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H27NO3/c1-14(2,3)19-13(18)16-10-8-15(9-11-16)6-4-12(17)5-7-15/h12,17H,4-11H2,1-3H3 | | InChIKey | NAFAKXTXWZJGHD-UHFFFAOYSA-N | | SMILES | C1C2(CCC(O)CC2)CCN(C(OC(C)(C)C)=O)C1 |
| | 9-Hydroxy-3-aza-spiro[5.5]undecane-3-carboxylic acid tert-butyl ester Usage And Synthesis |
| | 9-Hydroxy-3-aza-spiro[5.5]undecane-3-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|