3-(3,5-Difluorophenoxy)-propanoic acid manufacturers
- Tegoprazan Impurity
-
-
2025-12-16
- CAS:844648-19-7
- Min. Order: 10mg
- Purity: 99%+ HPLC
- Supply Ability: 1000
|
| | 3-(3,5-Difluorophenoxy)-propanoic acid Basic information |
| Product Name: | 3-(3,5-Difluorophenoxy)-propanoic acid | | Synonyms: | 3-(3,5-DIFLUOROPHENOXY)-PROPANOICACIED 1G;3-(3,5-Difluorophenoxy)propionic acid;Tegoprazan Impurity 31;3-(3,5-difluorophenoxy)-propanoicacied;Propanoic acid, 3-(3,5-difluorophenoxy)-;Tegoprazan Intermediate 1.1;3-(3,5-Difluorophenoxy)-propanoic acid | | CAS: | 844648-19-7 | | MF: | C9H8F2O3 | | MW: | 202.15 | | EINECS: | | | Product Categories: | | | Mol File: | 844648-19-7.mol |  |
| | 3-(3,5-Difluorophenoxy)-propanoic acid Chemical Properties |
| Boiling point | 246.1±25.0 °C(Predicted) | | density | 1.352±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 4.10±0.10(Predicted) | | Appearance | White Powder | | InChI | InChI=1S/C9H8F2O3/c10-6-3-7(11)5-8(4-6)14-2-1-9(12)13/h3-5H,1-2H2,(H,12,13) | | InChIKey | NJDIMXHZLXGAEW-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOC1=CC(F)=CC(F)=C1 |
| | 3-(3,5-Difluorophenoxy)-propanoic acid Usage And Synthesis |
| | 3-(3,5-Difluorophenoxy)-propanoic acid Preparation Products And Raw materials |
|