|
|
| | Benzyltriethylammonium hydroxide Basic information |
| | Benzyltriethylammonium hydroxide Chemical Properties |
| density | 0,92 g/cm3 | | refractive index | 1.4230 | | Fp | 26°C | | form | clear liquid | | color | Colorless to Almost colorless | | Sensitive | Air Sensitive | | BRN | 3737942 | | InChI | InChI=1S/C13H22N.H2O/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;/h7-11H,4-6,12H2,1-3H3;1H2/q+1;/p-1 | | InChIKey | FKPSBYZGRQJIMO-UHFFFAOYSA-M | | SMILES | [N+](CC)(CC)(CC)CC1C=CC=CC=1.[OH-] | | CAS DataBase Reference | 1836-42-6(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | Benzyltriethylammonium hydroxide Usage And Synthesis |
| Uses | Benzyltriethylammonium Hydroxide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | Benzyltriethylammonium hydroxide Preparation Products And Raw materials |
|