|
|
| | Elainic acid-1,2,3,7,8-13C5 Basic information |
| Product Name: | Elainic acid-1,2,3,7,8-13C5 | | Synonyms: | cis-9-Octadecenoic acid-1,2,3,7,8-13C5;Elainic acid-1,2,3,7,8-13C5;Oleic acid-1,2,3,7,8-13C5;Oleic acid-[13C5] (Solution);Oleic Acid-13C5;13C5]-Oleic acid;trans-9-Octadecenoic acid-1,2,3,7,8-13C5;Oleic acid-1,2,3,7,8-13C5 | | CAS: | 1255644-48-4 | | MF: | C18H34O2 | | MW: | 287.43 | | EINECS: | | | Product Categories: | | | Mol File: | 1255644-48-4.mol |  |
| | Elainic acid-1,2,3,7,8-13C5 Chemical Properties |
| Melting point | 42-44°C (lit.) | | Boiling point | 194-195°C/1.2mmHg (lit.) | | density | 0.910 g/mL at 25 °C(lit.) | | storage temp. | -20°C | | solubility | Chloroform: soluble,DMF: >100mg/mL,DMSO: >100mg/mL,Ethanol: >100mg/mL,PBS (pH 7.2): <100ug/mL | | form | solid | | InChI | 1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+/i11+1,12+1,16+1,17+1,18+1 | | InChIKey | ZQPPMHVWECSIRJ-CLWZAQNKSA-N | | SMILES | CCCCCCCC\C=C\[13CH2][13CH2]CCC[13CH2][13CH2][13C](O)=O |
| Hazard Codes | Xi | | Risk Statements | 38 | | WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | Elainic acid-1,2,3,7,8-13C5 Usage And Synthesis |
| Uses | Octadec-9-enoic acid-13C5 is a deuterated labeled Octadec-9-enoic acid-13C5[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
| | Elainic acid-1,2,3,7,8-13C5 Preparation Products And Raw materials |
|