| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
3A Chemicals |
| Tel: |
400-668-9898 |
| Email: |
service@3achem.com |
|
| Product Name: | NDI-C6 | | Synonyms: | 2,7-Dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone;N,N′-(1-Hexyl)-1,4,5,8-naphthalenetetracarboxydiamide;NDI-C6;NTDA-C6H13;Benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone, 2,7-dihexyl-;S1090;NTDA-C6;2,7-Dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone | | CAS: | 23536-15-4 | | MF: | C26H30N2O4 | | MW: | 434.53 | | EINECS: | | | Product Categories: | | | Mol File: | 23536-15-4.mol |  |
| | NDI-C6 Chemical Properties |
| Melting point | 205-210°C | | Boiling point | 606.7±38.0 °C(Predicted) | | density | 1.217±0.06 g/cm3(Predicted) | | pka | -2.50±0.20(Predicted) | | form | powder | | semiconductor properties | N-type (mobility=0.7cm2/V·s) | | λmax | 380360342 nm in dichloromethane (lit.) | | InChI | 1S/C26H30N2O4/c1-3-5-7-9-15-27-23(29)17-11-13-19-22-20(14-12-18(21(17)22)24(27)30)26(32)28(25(19)31)16-10-8-6-4-2/h11-14H,3-10,15-16H2,1-2H3 | | InChIKey | QGDZMDFMUJURJD-UHFFFAOYSA-N | | SMILES | CCCCCCN1C(=O)c2ccc3C(=O)N(CCCCCC)C(=O)c4ccc(C1=O)c2c34 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | NDI-C6 Usage And Synthesis |
| Uses | Used as an n-type semiconducting material in organic printed electronics. | | General Description | 2,7-Dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone is a low-molecular weight perylene derivative which is used as a n-type organic semiconductor in field-effect transistors (FETs). They have high electron mobilities and very good on/off current ratios even in the presence of air. They also possess good mechanical properties and good chemical resistance to a wide range of solvents. |
| | NDI-C6 Preparation Products And Raw materials |
|