| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3,4-Dihydro-2,5-dimethyl-2H-pyrano[2,3-b]quinoline Basic information |
| Product Name: | 3,4-Dihydro-2,5-dimethyl-2H-pyrano[2,3-b]quinoline | | Synonyms: | 3,4-Dihydro-2,5-dimethyl-2H-pyrano[2,3-b]quinoline;Li-Quinoline Ligand;2,5-Dimethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline;2H-Pyrano[2,3-b]quinoline, 3,4-dihydro-2,5-dimethyl- | | CAS: | 151657-37-3 | | MF: | C14H15NO | | MW: | 213.27 | | EINECS: | | | Product Categories: | | | Mol File: | 151657-37-3.mol | ![3,4-Dihydro-2,5-dimethyl-2H-pyrano[2,3-b]quinoline Structure](CAS/20180703/GIF/151657-37-3.gif) |
| | 3,4-Dihydro-2,5-dimethyl-2H-pyrano[2,3-b]quinoline Chemical Properties |
| Melting point | 143-147°C | | Boiling point | 367.9±21.0 °C(Predicted) | | density | 1.117±0.06 g/cm3(Predicted) | | pka | 4.26±0.40(Predicted) | | form | solid | | InChI | 1S/C14H15NO/c1-9-7-8-12-10(2)11-5-3-4-6-13(11)15-14(12)16-9/h3-6,9H,7-8H2,1-2H3 | | InChIKey | ZENOEMLZOZWVRD-UHFFFAOYSA-N | | SMILES | CC1=C2C(OC(C)CC2)=NC3=C1C=CC=C3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3,4-Dihydro-2,5-dimethyl-2H-pyrano[2,3-b]quinoline Usage And Synthesis |
| Uses | Ligand can be used in the presence of Pd(TFA)2 (Aldrich 299685) to promote C-H activation of β-Aryl-α-amino acids. This product has shown to be optimal with a 2:1 ratio of Ligand:Pd Source for several examples reported by the Yu group. | | reaction suitability | reagent type: catalyst
reagent type: ligand
reaction type: C-H Activation |
| | 3,4-Dihydro-2,5-dimethyl-2H-pyrano[2,3-b]quinoline Preparation Products And Raw materials |
|